C36H42O12 — CID 53305209
5-[4-[3,5-bis[4-(3,5-dihydroxyphenoxy)butoxy]phenoxy]butoxy]benzene-1,3-diol (PubChem CID 53305209) has the molecular formula C36H42O12 and a molecular weight of 666.72 g/mol. Its IUPAC name is 5-[4-[3,5-bis[4-(3,5-dihydroxyphenoxy)butoxy]phenoxy]butoxy]benzene-1,3-diol.
| Compound Name | 5-[4-[3,5-bis[4-(3,5-dihydroxyphenoxy)butoxy]phenoxy]butoxy]benzene-1,3-diol |
|---|---|
| PubChem CID | 53305209 |
| Molecular Formula | C36H42O12 |
| Molecular Weight | 666.72 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | 5-[4-[3,5-bis[4-(3,5-dihydroxyphenoxy)butoxy]phenoxy]butoxy]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(OCCCCOc2cc(OCCCCOc3cc(O)cc(O)c3)cc(OCCCCOc3cc(O)cc(O)c3)c2)c1 |
| InChI | InChI=1S/C36H42O12/c37-25-13-26(38)17-31(16-25)43-7-1-4-10-46-34-22-35(47-11-5-2-8-44-32-18-27(39)14-28(40)19-32)24-36(23-34)48-12-6-3-9-45-33-20-29(41)15-30(42)21-33/h13-24,37-42H,1-12H2 |
| InChIKey | HRRREYFWFNRABU-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.72 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|