C24H18O9 — CID 139830586
5-[3,5-bis(3,5-dihydroxyphenoxy)phenoxy]benzene-1,3-diol (PubChem CID 139830586) has the molecular formula C24H18O9 and a molecular weight of 450.40 g/mol. Its IUPAC name is 5-[3,5-bis(3,5-dihydroxyphenoxy)phenoxy]benzene-1,3-diol.
| Compound Name | 5-[3,5-bis(3,5-dihydroxyphenoxy)phenoxy]benzene-1,3-diol |
|---|---|
| PubChem CID | 139830586 |
| Molecular Formula | C24H18O9 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 5-[3,5-bis(3,5-dihydroxyphenoxy)phenoxy]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(Oc2cc(Oc3cc(O)cc(O)c3)cc(Oc3cc(O)cc(O)c3)c2)c1 |
| InChI | InChI=1S/C24H18O9/c25-13-1-14(26)5-19(4-13)31-22-10-23(32-20-6-15(27)2-16(28)7-20)12-24(11-22)33-21-8-17(29)3-18(30)9-21/h1-12,25-30H |
| InChIKey | DHSWBNUHFLMXNZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |