C18H13FO5S — CID 101498559
5-[4-(4-fluorophenyl)sulfonylphenoxy]benzene-1,3-diol (PubChem CID 101498559) has the molecular formula C18H13FO5S and a molecular weight of 360.36 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)sulfonylphenoxy]benzene-1,3-diol.
| Compound Name | 5-[4-(4-fluorophenyl)sulfonylphenoxy]benzene-1,3-diol |
|---|---|
| PubChem CID | 101498559 |
| Molecular Formula | C18H13FO5S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 5-[4-(4-fluorophenyl)sulfonylphenoxy]benzene-1,3-diol |
| SMILES | O=S(=O)(c1ccc(F)cc1)c1ccc(Oc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C18H13FO5S/c19-12-1-5-17(6-2-12)25(22,23)18-7-3-15(4-8-18)24-16-10-13(20)9-14(21)11-16/h1-11,20-21H |
| InChIKey | UDSJORDKSCCEOE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |