C12H9ClO3 — CID 123195227
5-(4-chlorophenoxy)benzene-1,3-diol (PubChem CID 123195227) has the molecular formula C12H9ClO3 and a molecular weight of 236.65 g/mol. Its IUPAC name is 5-(4-chlorophenoxy)benzene-1,3-diol.
| Compound Name | 5-(4-chlorophenoxy)benzene-1,3-diol |
|---|---|
| PubChem CID | 123195227 |
| Molecular Formula | C12H9ClO3 |
| Molecular Weight | 236.65 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 5-(4-chlorophenoxy)benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C12H9ClO3/c13-8-1-3-11(4-2-8)16-12-6-9(14)5-10(15)7-12/h1-7,14-15H |
| InChIKey | UFSACWMMXKQAFC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |