C22H14Cl2O4 — CID 19886874
2,3-bis(4-chlorophenoxy)naphthalene-1,4-diol (PubChem CID 19886874) has the molecular formula C22H14Cl2O4 and a molecular weight of 413.26 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenoxy)naphthalene-1,4-diol.
| Compound Name | 2,3-bis(4-chlorophenoxy)naphthalene-1,4-diol |
|---|---|
| PubChem CID | 19886874 |
| Molecular Formula | C22H14Cl2O4 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 2,3-bis(4-chlorophenoxy)naphthalene-1,4-diol |
| SMILES | Oc1c(Oc2ccc(Cl)cc2)c(Oc2ccc(Cl)cc2)c(O)c2ccccc12 |
| InChI | InChI=1S/C22H14Cl2O4/c23-13-5-9-15(10-6-13)27-21-19(25)17-3-1-2-4-18(17)20(26)22(21)28-16-11-7-14(24)8-12-16/h1-12,25-26H |
| InChIKey | SESJECZVKJMUHW-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|