acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol

C26H23ClO8 — CID 71331804

IUPACacetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol
SMILESCC(=O)O.CC(=O)O.Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(O)c2cc(Cl)ccc12
InChIInChI=1S/C22H15ClO4.2C2H4O2/c23-14-11-12-17-18(13-14)20(25)22(27-16-9-5-2-6-10-16)21(19(17)24)26-15-7-3-1-4-8-15;2*1-2(3)4/h1-13,24-25H;2*1H3,(H,3,4)
InChIKeyQIOQHUCVKNJOMO-UHFFFAOYSA-N
MW498.92 g/mol
LogP6.67
Rot. Bonds4

About acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol

acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol (PubChem CID 71331804) has the molecular formula C26H23ClO8 and a molecular weight of 498.92 g/mol. Its IUPAC name is acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol.

Molecular Properties

Compound Nameacetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol
PubChem CID71331804
Molecular FormulaC26H23ClO8
Molecular Weight498.92 g/mol
Exact Mass498.11
IUPAC Nameacetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol
SMILESCC(=O)O.CC(=O)O.Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(O)c2cc(Cl)ccc12
InChIInChI=1S/C22H15ClO4.2C2H4O2/c23-14-11-12-17-18(13-14)20(25)22(27-16-9-5-2-6-10-16)21(19(17)24)26-15-7-3-1-4-8-15;2*1-2(3)4/h1-13,24-25H;2*1H3,(H,3,4)
InChIKeyQIOQHUCVKNJOMO-UHFFFAOYSA-N
XLogP6.67
TPSA133.52 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms35
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500498.92
LogP ≤ 56.67
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroquinone', 'substructure': 'N/A'}

Analyze acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol?
The IUPAC name of acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol (CID 71331804) is acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol.
What is the SMILES notation for acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol?
The canonical SMILES for acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol is CC(=O)O.CC(=O)O.Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(O)c2cc(Cl)ccc12.
What is the InChIKey of acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol?
The InChIKey is QIOQHUCVKNJOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClO4.2C2H4O2/c23-14-11-12-17-18(13-14)20(25)22(27-16-9-5-2-6-10-16)21(19(17)24)26-15-7-3-1-4-8-15;2*1-2(3)4/h1-13,24-25H;2*1H3,(H,3,4).
What are the key properties of acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol?
acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol has a molecular weight of 498.92 g/mol, XLogP of 6.67, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol is sourced from PubChem (CID 71331804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).