C26H23ClO8 — CID 71331804
acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol (PubChem CID 71331804) has the molecular formula C26H23ClO8 and a molecular weight of 498.92 g/mol. Its IUPAC name is acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol.
| Compound Name | acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol |
|---|---|
| PubChem CID | 71331804 |
| Molecular Formula | C26H23ClO8 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | acetic acid;6-chloro-2,3-diphenoxynaphthalene-1,4-diol |
| SMILES | CC(=O)O.CC(=O)O.Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(O)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C22H15ClO4.2C2H4O2/c23-14-11-12-17-18(13-14)20(25)22(27-16-9-5-2-6-10-16)21(19(17)24)26-15-7-3-1-4-8-15;2*1-2(3)4/h1-13,24-25H;2*1H3,(H,3,4) |
| InChIKey | QIOQHUCVKNJOMO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|