C19H14O6 — CID 175281824
2,5-dihydroxy-3,4-diphenoxybenzoic acid (PubChem CID 175281824) has the molecular formula C19H14O6 and a molecular weight of 338.31 g/mol. Its IUPAC name is 2,5-dihydroxy-3,4-diphenoxybenzoic acid.
| Compound Name | 2,5-dihydroxy-3,4-diphenoxybenzoic acid |
|---|---|
| PubChem CID | 175281824 |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2,5-dihydroxy-3,4-diphenoxybenzoic acid |
| SMILES | O=C(O)c1cc(O)c(Oc2ccccc2)c(Oc2ccccc2)c1O |
| InChI | InChI=1S/C19H14O6/c20-15-11-14(19(22)23)16(21)18(25-13-9-5-2-6-10-13)17(15)24-12-7-3-1-4-8-12/h1-11,20-21H,(H,22,23) |
| InChIKey | AAVDNWGYZWOPFL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|