C22H16O4 — CID 19886586
2,3-diphenoxynaphthalene-1,4-diol (PubChem CID 19886586) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2,3-diphenoxynaphthalene-1,4-diol.
| Compound Name | 2,3-diphenoxynaphthalene-1,4-diol |
|---|---|
| PubChem CID | 19886586 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2,3-diphenoxynaphthalene-1,4-diol |
| SMILES | Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(O)c2ccccc12 |
| InChI | InChI=1S/C22H16O4/c23-19-17-13-7-8-14-18(17)20(24)22(26-16-11-5-2-6-12-16)21(19)25-15-9-3-1-4-10-15/h1-14,23-24H |
| InChIKey | FWOLBWUDWCCCSG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|