C24H17ClO5 — CID 23038628
(7-chloro-4-hydroxy-2,3-diphenoxynaphthalen-1-yl) acetate (PubChem CID 23038628) has the molecular formula C24H17ClO5 and a molecular weight of 420.85 g/mol. Its IUPAC name is (7-chloro-4-hydroxy-2,3-diphenoxynaphthalen-1-yl) acetate.
| Compound Name | (7-chloro-4-hydroxy-2,3-diphenoxynaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 23038628 |
| Molecular Formula | C24H17ClO5 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (7-chloro-4-hydroxy-2,3-diphenoxynaphthalen-1-yl) acetate |
| SMILES | CC(=O)Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(O)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H17ClO5/c1-15(26)28-22-20-14-16(25)12-13-19(20)21(27)23(29-17-8-4-2-5-9-17)24(22)30-18-10-6-3-7-11-18/h2-14,27H,1H3 |
| InChIKey | QEEWLTKWSOAPBW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|