C22H29ClO5 — CID 23038828
[6-chloro-2,3-bis(2,2-dimethylpropoxy)-4-hydroxynaphthalen-1-yl] acetate (PubChem CID 23038828) has the molecular formula C22H29ClO5 and a molecular weight of 408.92 g/mol. Its IUPAC name is [6-chloro-2,3-bis(2,2-dimethylpropoxy)-4-hydroxynaphthalen-1-yl] acetate.
| Compound Name | [6-chloro-2,3-bis(2,2-dimethylpropoxy)-4-hydroxynaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 23038828 |
| Molecular Formula | C22H29ClO5 |
| Molecular Weight | 408.92 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [6-chloro-2,3-bis(2,2-dimethylpropoxy)-4-hydroxynaphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(OCC(C)(C)C)c(OCC(C)(C)C)c(O)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C22H29ClO5/c1-13(24)28-18-15-9-8-14(23)10-16(15)17(25)19(26-11-21(2,3)4)20(18)27-12-22(5,6)7/h8-10,25H,11-12H2,1-7H3 |
| InChIKey | KEONSCZDGAWIMF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.92 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|