C24H33ClO5 — CID 149158610
[2,3-di(butan-2-yloxy)-4-butoxy-6-chloronaphthalen-1-yl] acetate (PubChem CID 149158610) has the molecular formula C24H33ClO5 and a molecular weight of 436.98 g/mol. Its IUPAC name is [2,3-di(butan-2-yloxy)-4-butoxy-6-chloronaphthalen-1-yl] acetate.
| Compound Name | [2,3-di(butan-2-yloxy)-4-butoxy-6-chloronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 149158610 |
| Molecular Formula | C24H33ClO5 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [2,3-di(butan-2-yloxy)-4-butoxy-6-chloronaphthalen-1-yl] acetate |
| SMILES | CCCCOc1c(OC(C)CC)c(OC(C)CC)c(OC(C)=O)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H33ClO5/c1-7-10-13-27-21-20-14-18(25)11-12-19(20)22(30-17(6)26)24(29-16(5)9-3)23(21)28-15(4)8-2/h11-12,14-16H,7-10,13H2,1-6H3 |
| InChIKey | LNHXERWQYNAXIT-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|