C20H26O5 — CID 149158265
(4-butoxy-2,3-dimethoxy-6,7-dimethylnaphthalen-1-yl) acetate (PubChem CID 149158265) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (4-butoxy-2,3-dimethoxy-6,7-dimethylnaphthalen-1-yl) acetate.
| Compound Name | (4-butoxy-2,3-dimethoxy-6,7-dimethylnaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 149158265 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (4-butoxy-2,3-dimethoxy-6,7-dimethylnaphthalen-1-yl) acetate |
| SMILES | CCCCOc1c(OC)c(OC)c(OC(C)=O)c2cc(C)c(C)cc12 |
| InChI | InChI=1S/C20H26O5/c1-7-8-9-24-17-15-10-12(2)13(3)11-16(15)18(25-14(4)21)20(23-6)19(17)22-5/h10-11H,7-9H2,1-6H3 |
| InChIKey | PPLWGTMSLSTDSP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|