C14H22O3 — CID 10633685
2-butoxy-1,4-dimethoxy-3,5-dimethylbenzene (PubChem CID 10633685) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-butoxy-1,4-dimethoxy-3,5-dimethylbenzene.
| Compound Name | 2-butoxy-1,4-dimethoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 10633685 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-butoxy-1,4-dimethoxy-3,5-dimethylbenzene |
| SMILES | CCCCOc1c(OC)cc(C)c(OC)c1C |
| InChI | InChI=1S/C14H22O3/c1-6-7-8-17-14-11(3)13(16-5)10(2)9-12(14)15-4/h9H,6-8H2,1-5H3 |
| InChIKey | SIVBOHHHEACMGH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|