C16H26O3 — CID 90435242
2,5-dibutoxy-3,6-dimethylphenol (PubChem CID 90435242) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2,5-dibutoxy-3,6-dimethylphenol.
| Compound Name | 2,5-dibutoxy-3,6-dimethylphenol |
|---|---|
| PubChem CID | 90435242 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2,5-dibutoxy-3,6-dimethylphenol |
| SMILES | CCCCOc1cc(C)c(OCCCC)c(O)c1C |
| InChI | InChI=1S/C16H26O3/c1-5-7-9-18-14-11-12(3)16(15(17)13(14)4)19-10-8-6-2/h11,17H,5-10H2,1-4H3 |
| InChIKey | MYKUNMYIUGXRBZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|