C12H18O2 — CID 139788128
3-butoxy-2,5-dimethylphenol (PubChem CID 139788128) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-butoxy-2,5-dimethylphenol.
| Compound Name | 3-butoxy-2,5-dimethylphenol |
|---|---|
| PubChem CID | 139788128 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-butoxy-2,5-dimethylphenol |
| SMILES | CCCCOc1cc(C)cc(O)c1C |
| InChI | InChI=1S/C12H18O2/c1-4-5-6-14-12-8-9(2)7-11(13)10(12)3/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | TUJFLRHUAHFKIR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|