C9H12O3 — CID 130032613
5-ethoxy-4-methylbenzene-1,3-diol (PubChem CID 130032613) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 5-ethoxy-4-methylbenzene-1,3-diol.
| Compound Name | 5-ethoxy-4-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 130032613 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 5-ethoxy-4-methylbenzene-1,3-diol |
| SMILES | CCOc1cc(O)cc(O)c1C |
| InChI | InChI=1S/C9H12O3/c1-3-12-9-5-7(10)4-8(11)6(9)2/h4-5,10-11H,3H2,1-2H3 |
| InChIKey | LYSIZMPEWBMEPL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |