C12H18O4 — CID 19754898
3,4,5-triethoxyphenol (PubChem CID 19754898) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3,4,5-triethoxyphenol.
| Compound Name | 3,4,5-triethoxyphenol |
|---|---|
| PubChem CID | 19754898 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3,4,5-triethoxyphenol |
| SMILES | CCOc1cc(O)cc(OCC)c1OCC |
| InChI | InChI=1S/C12H18O4/c1-4-14-10-7-9(13)8-11(15-5-2)12(10)16-6-3/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | GRXDVBUGOWLXAZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |