C17H28O4 — CID 115823357
2-methyl-1-(3,4,5-triethoxyphenyl)butan-1-ol (PubChem CID 115823357) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-methyl-1-(3,4,5-triethoxyphenyl)butan-1-ol.
| Compound Name | 2-methyl-1-(3,4,5-triethoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 115823357 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-methyl-1-(3,4,5-triethoxyphenyl)butan-1-ol |
| SMILES | CCOc1cc(C(O)C(C)CC)cc(OCC)c1OCC |
| InChI | InChI=1S/C17H28O4/c1-6-12(5)16(18)13-10-14(19-7-2)17(21-9-4)15(11-13)20-8-3/h10-12,16,18H,6-9H2,1-5H3 |
| InChIKey | JQRJANQAYLPPQP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |