C12H18O2 — CID 97294345
(1S)-1-(4-ethoxy-3,5-dimethylphenyl)ethanol (PubChem CID 97294345) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S)-1-(4-ethoxy-3,5-dimethylphenyl)ethanol.
| Compound Name | (1S)-1-(4-ethoxy-3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 97294345 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1S)-1-(4-ethoxy-3,5-dimethylphenyl)ethanol |
| SMILES | CCOc1c(C)cc([C@H](C)O)cc1C |
| InChI | InChI=1S/C12H18O2/c1-5-14-12-8(2)6-11(10(4)13)7-9(12)3/h6-7,10,13H,5H2,1-4H3/t10-/m0/s1 |
| InChIKey | HRLUWVGTZFSBCD-JTQLQIEISA-N |
| XLogP | 2.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |