C11H16O2 — CID 130882299
2-ethoxy-5-methoxy-1,3-dimethylbenzene (PubChem CID 130882299) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-ethoxy-5-methoxy-1,3-dimethylbenzene.
| Compound Name | 2-ethoxy-5-methoxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 130882299 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-ethoxy-5-methoxy-1,3-dimethylbenzene |
| SMILES | CCOc1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C11H16O2/c1-5-13-11-8(2)6-10(12-4)7-9(11)3/h6-7H,5H2,1-4H3 |
| InChIKey | WSFFDACWVVLMGO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |