C10H13NO3 — CID 13343824
2-ethoxy-1,3-dimethyl-5-nitrobenzene (PubChem CID 13343824) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-ethoxy-1,3-dimethyl-5-nitrobenzene.
| Compound Name | 2-ethoxy-1,3-dimethyl-5-nitrobenzene |
|---|---|
| PubChem CID | 13343824 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-ethoxy-1,3-dimethyl-5-nitrobenzene |
| SMILES | CCOc1c(C)cc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C10H13NO3/c1-4-14-10-7(2)5-9(11(12)13)6-8(10)3/h5-6H,4H2,1-3H3 |
| InChIKey | SZCGXJFNMIHJAF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|