C14H19NO7 — CID 158548849
2-(2,6-dimethyl-4-nitrophenoxy)acetic acid;ethyl acetate (PubChem CID 158548849) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-nitrophenoxy)acetic acid;ethyl acetate.
| Compound Name | 2-(2,6-dimethyl-4-nitrophenoxy)acetic acid;ethyl acetate |
|---|---|
| PubChem CID | 158548849 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(2,6-dimethyl-4-nitrophenoxy)acetic acid;ethyl acetate |
| SMILES | CCOC(C)=O.Cc1cc([N+](=O)[O-])cc(C)c1OCC(=O)O |
| InChI | InChI=1S/C10H11NO5.C4H8O2/c1-6-3-8(11(14)15)4-7(2)10(6)16-5-9(12)13;1-3-6-4(2)5/h3-4H,5H2,1-2H3,(H,12,13);3H2,1-2H3 |
| InChIKey | HPLQITPGHUOZSX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|