C11H13ClN2O5S — CID 106439097
2-(3-chloro-2-methylprop-2-enoxy)-3-methyl-5-nitrobenzenesulfonamide (PubChem CID 106439097) has the molecular formula C11H13ClN2O5S and a molecular weight of 320.75 g/mol. Its IUPAC name is 2-(3-chloro-2-methylprop-2-enoxy)-3-methyl-5-nitrobenzenesulfonamide.
| Compound Name | 2-(3-chloro-2-methylprop-2-enoxy)-3-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106439097 |
| Molecular Formula | C11H13ClN2O5S |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-(3-chloro-2-methylprop-2-enoxy)-3-methyl-5-nitrobenzenesulfonamide |
| SMILES | CC(=CCl)COc1c(C)cc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H13ClN2O5S/c1-7(5-12)6-19-11-8(2)3-9(14(15)16)4-10(11)20(13,17)18/h3-5H,6H2,1-2H3,(H2,13,17,18) |
| InChIKey | NZESHPSDMAQMJZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|