C10H11ClN2O6S — CID 82915272
3-[(E)-3-chloroprop-2-enoxy]-2-methoxy-5-nitrobenzenesulfonamide (PubChem CID 82915272) has the molecular formula C10H11ClN2O6S and a molecular weight of 322.73 g/mol. Its IUPAC name is 3-[(E)-3-chloroprop-2-enoxy]-2-methoxy-5-nitrobenzenesulfonamide.
| Compound Name | 3-[(E)-3-chloroprop-2-enoxy]-2-methoxy-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 82915272 |
| Molecular Formula | C10H11ClN2O6S |
| Molecular Weight | 322.73 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 3-[(E)-3-chloroprop-2-enoxy]-2-methoxy-5-nitrobenzenesulfonamide |
| SMILES | COc1c(OC/C=C/Cl)cc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H11ClN2O6S/c1-18-10-8(19-4-2-3-11)5-7(13(14)15)6-9(10)20(12,16)17/h2-3,5-6H,4H2,1H3,(H2,12,16,17)/b3-2+ |
| InChIKey | FAFXODPMONLZAS-NSCUHMNNSA-N |
| XLogP | 1.38 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.73 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|