C12H17FN2O5S — CID 61481383
2-(3,3-dimethylbutoxy)-3-fluoro-5-nitrobenzenesulfonamide (PubChem CID 61481383) has the molecular formula C12H17FN2O5S and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)-3-fluoro-5-nitrobenzenesulfonamide.
| Compound Name | 2-(3,3-dimethylbutoxy)-3-fluoro-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 61481383 |
| Molecular Formula | C12H17FN2O5S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)-3-fluoro-5-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)CCOc1c(F)cc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H17FN2O5S/c1-12(2,3)4-5-20-11-9(13)6-8(15(16)17)7-10(11)21(14,18)19/h6-7H,4-5H2,1-3H3,(H2,14,18,19) |
| InChIKey | KTNIGJBOGXEVOT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|