C9H11FN2O6S — CID 80695759
3-(2-fluoroethoxy)-2-methoxy-5-nitrobenzenesulfonamide (PubChem CID 80695759) has the molecular formula C9H11FN2O6S and a molecular weight of 294.26 g/mol. Its IUPAC name is 3-(2-fluoroethoxy)-2-methoxy-5-nitrobenzenesulfonamide.
| Compound Name | 3-(2-fluoroethoxy)-2-methoxy-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 80695759 |
| Molecular Formula | C9H11FN2O6S |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 3-(2-fluoroethoxy)-2-methoxy-5-nitrobenzenesulfonamide |
| SMILES | COc1c(OCCF)cc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H11FN2O6S/c1-17-9-7(18-3-2-10)4-6(12(13)14)5-8(9)19(11,15)16/h4-5H,2-3H2,1H3,(H2,11,15,16) |
| InChIKey | HLHDVYRLPSYDEB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|