C12H18N2O5S — CID 83157782
2-(4-methylpentoxy)-5-nitrobenzenesulfonamide (PubChem CID 83157782) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-(4-methylpentoxy)-5-nitrobenzenesulfonamide.
| Compound Name | 2-(4-methylpentoxy)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 83157782 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(4-methylpentoxy)-5-nitrobenzenesulfonamide |
| SMILES | CC(C)CCCOc1ccc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H18N2O5S/c1-9(2)4-3-7-19-11-6-5-10(14(15)16)8-12(11)20(13,17)18/h5-6,8-9H,3-4,7H2,1-2H3,(H2,13,17,18) |
| InChIKey | IPJXGPACGWHHGF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|