C17H27NO4 — CID 163715158
1-(3,7-dimethyloctoxy)-2-methoxy-4-nitrobenzene (PubChem CID 163715158) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-(3,7-dimethyloctoxy)-2-methoxy-4-nitrobenzene.
| Compound Name | 1-(3,7-dimethyloctoxy)-2-methoxy-4-nitrobenzene |
|---|---|
| PubChem CID | 163715158 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-(3,7-dimethyloctoxy)-2-methoxy-4-nitrobenzene |
| SMILES | COc1cc([N+](=O)[O-])ccc1OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C17H27NO4/c1-13(2)6-5-7-14(3)10-11-22-16-9-8-15(18(19)20)12-17(16)21-4/h8-9,12-14H,5-7,10-11H2,1-4H3 |
| InChIKey | KMRRIHQPBFUATE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|