C21H26N4O6 — CID 24531838
3-methoxy-N'-[2-(methylamino)-5-nitrobenzoyl]-4-(3-methylbutoxy)benzohydrazide (PubChem CID 24531838) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-methoxy-N'-[2-(methylamino)-5-nitrobenzoyl]-4-(3-methylbutoxy)benzohydrazide.
| Compound Name | 3-methoxy-N'-[2-(methylamino)-5-nitrobenzoyl]-4-(3-methylbutoxy)benzohydrazide |
|---|---|
| PubChem CID | 24531838 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3-methoxy-N'-[2-(methylamino)-5-nitrobenzoyl]-4-(3-methylbutoxy)benzohydrazide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)NNC(=O)c1ccc(OCCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C21H26N4O6/c1-13(2)9-10-31-18-8-5-14(11-19(18)30-4)20(26)23-24-21(27)16-12-15(25(28)29)6-7-17(16)22-3/h5-8,11-13,22H,9-10H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | CYLYTZGXIWWUHO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|