C23H30N4O7 — CID 24515194
4-(2-methoxyethylamino)-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-3-nitrobenzohydrazide (PubChem CID 24515194) has the molecular formula C23H30N4O7 and a molecular weight of 474.51 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-3-nitrobenzohydrazide.
| Compound Name | 4-(2-methoxyethylamino)-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 24515194 |
| Molecular Formula | C23H30N4O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 4-(2-methoxyethylamino)-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-3-nitrobenzohydrazide |
| SMILES | COCCNc1ccc(C(=O)NNC(=O)c2ccc(OCCC(C)C)c(OC)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H30N4O7/c1-15(2)9-11-34-20-8-6-17(14-21(20)33-4)23(29)26-25-22(28)16-5-7-18(24-10-12-32-3)19(13-16)27(30)31/h5-8,13-15,24H,9-12H2,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | LULNBNUJVAIMFQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|