C17H27N3O5 — CID 119037026
N-[2-(hydroxymethyl)-4-methylpentyl]-4-(2-methoxyethylamino)-3-nitrobenzamide (PubChem CID 119037026) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)-4-methylpentyl]-4-(2-methoxyethylamino)-3-nitrobenzamide.
| Compound Name | N-[2-(hydroxymethyl)-4-methylpentyl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 119037026 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[2-(hydroxymethyl)-4-methylpentyl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
| SMILES | COCCNc1ccc(C(=O)NCC(CO)CC(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H27N3O5/c1-12(2)8-13(11-21)10-19-17(22)14-4-5-15(18-6-7-25-3)16(9-14)20(23)24/h4-5,9,12-13,18,21H,6-8,10-11H2,1-3H3,(H,19,22) |
| InChIKey | OJQWMUHXRMPESM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|