C21H26N2O5 — CID 25486360
3-methoxy-N'-(2-methoxybenzoyl)-4-(3-methylbutoxy)benzohydrazide (PubChem CID 25486360) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-methoxy-N'-(2-methoxybenzoyl)-4-(3-methylbutoxy)benzohydrazide.
| Compound Name | 3-methoxy-N'-(2-methoxybenzoyl)-4-(3-methylbutoxy)benzohydrazide |
|---|---|
| PubChem CID | 25486360 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-methoxy-N'-(2-methoxybenzoyl)-4-(3-methylbutoxy)benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccccc2OC)ccc1OCCC(C)C |
| InChI | InChI=1S/C21H26N2O5/c1-14(2)11-12-28-18-10-9-15(13-19(18)27-4)20(24)22-23-21(25)16-7-5-6-8-17(16)26-3/h5-10,13-14H,11-12H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | SNTLDRNTZDQPIO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|