C20H24FN3O3S — CID 8788648
1-(2-fluorophenyl)-3-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]thiourea (PubChem CID 8788648) has the molecular formula C20H24FN3O3S and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 8788648 |
| Molecular Formula | C20H24FN3O3S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]thiourea |
| SMILES | COc1cc(C(=O)NNC(=S)Nc2ccccc2F)ccc1OCCC(C)C |
| InChI | InChI=1S/C20H24FN3O3S/c1-13(2)10-11-27-17-9-8-14(12-18(17)26-3)19(25)23-24-20(28)22-16-7-5-4-6-15(16)21/h4-9,12-13H,10-11H2,1-3H3,(H,23,25)(H2,22,24,28) |
| InChIKey | OLNPVBNEVKRCAW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|