C17H16FN3O4S — CID 4950541
N-[[(3,4-dimethoxybenzoyl)amino]carbamothioyl]-2-fluorobenzamide (PubChem CID 4950541) has the molecular formula C17H16FN3O4S and a molecular weight of 377.40 g/mol. Its IUPAC name is N-[[(3,4-dimethoxybenzoyl)amino]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[(3,4-dimethoxybenzoyl)amino]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4950541 |
| Molecular Formula | C17H16FN3O4S |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[[(3,4-dimethoxybenzoyl)amino]carbamothioyl]-2-fluorobenzamide |
| SMILES | COc1ccc(C(=O)NNC(=S)NC(=O)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C17H16FN3O4S/c1-24-13-8-7-10(9-14(13)25-2)15(22)20-21-17(26)19-16(23)11-5-3-4-6-12(11)18/h3-9H,1-2H3,(H,20,22)(H2,19,21,23,26) |
| InChIKey | JUOKXYVTSQNKQM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|