C17H16FN3O5 — CID 9084762
2-[4-[[(2-fluorobenzoyl)amino]carbamoyl]-2-methoxyphenoxy]acetamide (PubChem CID 9084762) has the molecular formula C17H16FN3O5 and a molecular weight of 361.33 g/mol. Its IUPAC name is 2-[4-[[(2-fluorobenzoyl)amino]carbamoyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[[(2-fluorobenzoyl)amino]carbamoyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 9084762 |
| Molecular Formula | C17H16FN3O5 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[4-[[(2-fluorobenzoyl)amino]carbamoyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccccc2F)ccc1OCC(N)=O |
| InChI | InChI=1S/C17H16FN3O5/c1-25-14-8-10(6-7-13(14)26-9-15(19)22)16(23)20-21-17(24)11-4-2-3-5-12(11)18/h2-8H,9H2,1H3,(H2,19,22)(H,20,23)(H,21,24) |
| InChIKey | LLXAPVIBBBUBBR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|