C19H20FN3O6 — CID 55413100
2-[4-[[2-(2-fluorophenoxy)propanoylamino]carbamoyl]-2-methoxyphenoxy]acetamide (PubChem CID 55413100) has the molecular formula C19H20FN3O6 and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-[4-[[2-(2-fluorophenoxy)propanoylamino]carbamoyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[[2-(2-fluorophenoxy)propanoylamino]carbamoyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 55413100 |
| Molecular Formula | C19H20FN3O6 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[4-[[2-(2-fluorophenoxy)propanoylamino]carbamoyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C(=O)NNC(=O)C(C)Oc2ccccc2F)ccc1OCC(N)=O |
| InChI | InChI=1S/C19H20FN3O6/c1-11(29-14-6-4-3-5-13(14)20)18(25)22-23-19(26)12-7-8-15(16(9-12)27-2)28-10-17(21)24/h3-9,11H,10H2,1-2H3,(H2,21,24)(H,22,25)(H,23,26) |
| InChIKey | MNNUCQATYAUANE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|