C17H16FN3O6 — CID 7927420
N'-[(2S)-2-(2-fluorophenoxy)propanoyl]-4-methoxy-3-nitrobenzohydrazide (PubChem CID 7927420) has the molecular formula C17H16FN3O6 and a molecular weight of 377.33 g/mol. Its IUPAC name is N'-[(2S)-2-(2-fluorophenoxy)propanoyl]-4-methoxy-3-nitrobenzohydrazide.
| Compound Name | N'-[(2S)-2-(2-fluorophenoxy)propanoyl]-4-methoxy-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 7927420 |
| Molecular Formula | C17H16FN3O6 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N'-[(2S)-2-(2-fluorophenoxy)propanoyl]-4-methoxy-3-nitrobenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)[C@H](C)Oc2ccccc2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16FN3O6/c1-10(27-14-6-4-3-5-12(14)18)16(22)19-20-17(23)11-7-8-15(26-2)13(9-11)21(24)25/h3-10H,1-2H3,(H,19,22)(H,20,23)/t10-/m0/s1 |
| InChIKey | JQNHOOYWGVOCHF-JTQLQIEISA-N |
| XLogP | 1.97 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|