C23H20ClFN4O5 — CID 55342062
4-[(2-chlorophenyl)methylamino]-N'-[2-(2-fluorophenoxy)propanoyl]-3-nitrobenzohydrazide (PubChem CID 55342062) has the molecular formula C23H20ClFN4O5 and a molecular weight of 486.89 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylamino]-N'-[2-(2-fluorophenoxy)propanoyl]-3-nitrobenzohydrazide.
| Compound Name | 4-[(2-chlorophenyl)methylamino]-N'-[2-(2-fluorophenoxy)propanoyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 55342062 |
| Molecular Formula | C23H20ClFN4O5 |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 4-[(2-chlorophenyl)methylamino]-N'-[2-(2-fluorophenoxy)propanoyl]-3-nitrobenzohydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)c1ccc(NCc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20ClFN4O5/c1-14(34-21-9-5-4-8-18(21)25)22(30)27-28-23(31)15-10-11-19(20(12-15)29(32)33)26-13-16-6-2-3-7-17(16)24/h2-12,14,26H,13H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | DWQFWJHOEPJMNX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|