C18H17ClN2O6 — CID 9003341
methyl 4-[(2S)-1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]oxy-3-nitrobenzoate (PubChem CID 9003341) has the molecular formula C18H17ClN2O6 and a molecular weight of 392.80 g/mol. Its IUPAC name is methyl 4-[(2S)-1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]oxy-3-nitrobenzoate.
| Compound Name | methyl 4-[(2S)-1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]oxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 9003341 |
| Molecular Formula | C18H17ClN2O6 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | methyl 4-[(2S)-1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]oxy-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(O[C@@H](C)C(=O)NCc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17ClN2O6/c1-11(17(22)20-10-13-5-3-4-6-14(13)19)27-16-8-7-12(18(23)26-2)9-15(16)21(24)25/h3-9,11H,10H2,1-2H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | FEQIYXMUCZFUND-NSHDSACASA-N |
| XLogP | 3.12 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|