C21H18ClN3O3 — CID 4676214
4-[(2-chlorophenyl)methylamino]-N-(4-methylphenyl)-3-nitrobenzamide (PubChem CID 4676214) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylamino]-N-(4-methylphenyl)-3-nitrobenzamide.
| Compound Name | 4-[(2-chlorophenyl)methylamino]-N-(4-methylphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 4676214 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 4-[(2-chlorophenyl)methylamino]-N-(4-methylphenyl)-3-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NCc3ccccc3Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H18ClN3O3/c1-14-6-9-17(10-7-14)24-21(26)15-8-11-19(20(12-15)25(27)28)23-13-16-4-2-3-5-18(16)22/h2-12,23H,13H2,1H3,(H,24,26) |
| InChIKey | MVKMKOLRGXDGHJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|