C16H18ClN4O3+ — CID 7327095
2-[4-[(3-chloro-4-methylphenyl)carbamoyl]-2-nitroanilino]ethylazanium (PubChem CID 7327095) has the molecular formula C16H18ClN4O3+ and a molecular weight of 349.80 g/mol. Its IUPAC name is 2-[4-[(3-chloro-4-methylphenyl)carbamoyl]-2-nitroanilino]ethylazanium.
| Compound Name | 2-[4-[(3-chloro-4-methylphenyl)carbamoyl]-2-nitroanilino]ethylazanium |
|---|---|
| PubChem CID | 7327095 |
| Molecular Formula | C16H18ClN4O3+ |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-[4-[(3-chloro-4-methylphenyl)carbamoyl]-2-nitroanilino]ethylazanium |
| SMILES | Cc1ccc(NC(=O)c2ccc(NCC[NH3+])c([N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C16H17ClN4O3/c1-10-2-4-12(9-13(10)17)20-16(22)11-3-5-14(19-7-6-18)15(8-11)21(23)24/h2-5,8-9,19H,6-7,18H2,1H3,(H,20,22)/p+1 |
| InChIKey | FOWSNFKJHDEAHG-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|