C24H23ClN4O4 — CID 5092379
4-[(2-chlorophenyl)methylamino]-N-(2-morpholin-4-ylphenyl)-3-nitrobenzamide (PubChem CID 5092379) has the molecular formula C24H23ClN4O4 and a molecular weight of 466.93 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylamino]-N-(2-morpholin-4-ylphenyl)-3-nitrobenzamide.
| Compound Name | 4-[(2-chlorophenyl)methylamino]-N-(2-morpholin-4-ylphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 5092379 |
| Molecular Formula | C24H23ClN4O4 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 4-[(2-chlorophenyl)methylamino]-N-(2-morpholin-4-ylphenyl)-3-nitrobenzamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)c1ccc(NCc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23ClN4O4/c25-19-6-2-1-5-18(19)16-26-20-10-9-17(15-23(20)29(31)32)24(30)27-21-7-3-4-8-22(21)28-11-13-33-14-12-28/h1-10,15,26H,11-14,16H2,(H,27,30) |
| InChIKey | UCEUFEKZFRFMIQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|