C21H23ClN4O5 — CID 4824096
4-chloro-N-(2,4-dimorpholin-4-ylphenyl)-3-nitrobenzamide (PubChem CID 4824096) has the molecular formula C21H23ClN4O5 and a molecular weight of 446.89 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dimorpholin-4-ylphenyl)-3-nitrobenzamide.
| Compound Name | 4-chloro-N-(2,4-dimorpholin-4-ylphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 4824096 |
| Molecular Formula | C21H23ClN4O5 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-chloro-N-(2,4-dimorpholin-4-ylphenyl)-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1N1CCOCC1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23ClN4O5/c22-17-3-1-15(13-19(17)26(28)29)21(27)23-18-4-2-16(24-5-9-30-10-6-24)14-20(18)25-7-11-31-12-8-25/h1-4,13-14H,5-12H2,(H,23,27) |
| InChIKey | OMIZOMQHBHZDHP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|