C14H10ClN2O4- — CID 7062960
4-[(2-chlorophenyl)methylamino]-3-nitrobenzoate (PubChem CID 7062960) has the molecular formula C14H10ClN2O4- and a molecular weight of 305.70 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylamino]-3-nitrobenzoate.
| Compound Name | 4-[(2-chlorophenyl)methylamino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 7062960 |
| Molecular Formula | C14H10ClN2O4- |
| Molecular Weight | 305.70 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 4-[(2-chlorophenyl)methylamino]-3-nitrobenzoate |
| SMILES | O=C([O-])c1ccc(NCc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11ClN2O4/c15-11-4-2-1-3-10(11)8-16-12-6-5-9(14(18)19)7-13(12)17(20)21/h1-7,16H,8H2,(H,18,19)/p-1 |
| InChIKey | XTCRJJGPZZPVHF-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.70 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|