C22H21ClN4O5S — CID 27538218
4-[(2-chlorophenyl)methylamino]-3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 27538218) has the molecular formula C22H21ClN4O5S and a molecular weight of 488.95 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylamino]-3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 4-[(2-chlorophenyl)methylamino]-3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 27538218 |
| Molecular Formula | C22H21ClN4O5S |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 4-[(2-chlorophenyl)methylamino]-3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2ccc(NCc3ccccc3Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H21ClN4O5S/c23-19-4-2-1-3-17(19)14-26-20-10-7-16(13-21(20)27(29)30)22(28)25-12-11-15-5-8-18(9-6-15)33(24,31)32/h1-10,13,26H,11-12,14H2,(H,25,28)(H2,24,31,32) |
| InChIKey | QZLWDUAAKZQTOW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|