C18H17ClN6O3S — CID 56577359
4-[(2-chlorophenyl)methylamino]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide (PubChem CID 56577359) has the molecular formula C18H17ClN6O3S and a molecular weight of 432.89 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylamino]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide.
| Compound Name | 4-[(2-chlorophenyl)methylamino]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 56577359 |
| Molecular Formula | C18H17ClN6O3S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-[(2-chlorophenyl)methylamino]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide |
| SMILES | Cn1c(CNC(=O)c2ccc(NCc3ccccc3Cl)c([N+](=O)[O-])c2)n[nH]c1=S |
| InChI | InChI=1S/C18H17ClN6O3S/c1-24-16(22-23-18(24)29)10-21-17(26)11-6-7-14(15(8-11)25(27)28)20-9-12-4-2-3-5-13(12)19/h2-8,20H,9-10H2,1H3,(H,21,26)(H,23,29) |
| InChIKey | OGLUKAZFUZLEJN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|