C18H22Cl2N4O3 — CID 119583080
N-(1-aminopropan-2-yl)-4-[(2-chlorophenyl)methylamino]-N-methyl-3-nitrobenzamide;hydrochloride (PubChem CID 119583080) has the molecular formula C18H22Cl2N4O3 and a molecular weight of 413.31 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-4-[(2-chlorophenyl)methylamino]-N-methyl-3-nitrobenzamide;hydrochloride.
| Compound Name | N-(1-aminopropan-2-yl)-4-[(2-chlorophenyl)methylamino]-N-methyl-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119583080 |
| Molecular Formula | C18H22Cl2N4O3 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-(1-aminopropan-2-yl)-4-[(2-chlorophenyl)methylamino]-N-methyl-3-nitrobenzamide;hydrochloride |
| SMILES | CC(CN)N(C)C(=O)c1ccc(NCc2ccccc2Cl)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C18H21ClN4O3.ClH/c1-12(10-20)22(2)18(24)13-7-8-16(17(9-13)23(25)26)21-11-14-5-3-4-6-15(14)19;/h3-9,12,21H,10-11,20H2,1-2H3;1H |
| InChIKey | LNQRTJMOHYKHMY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|