C19H21ClN4O3 — CID 119632608
[2-(aminomethyl)pyrrolidin-1-yl]-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]methanone (PubChem CID 119632608) has the molecular formula C19H21ClN4O3 and a molecular weight of 388.86 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]methanone.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 119632608 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]methanone |
| SMILES | NCC1CCCN1C(=O)c1ccc(NCc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21ClN4O3/c20-16-6-2-1-4-14(16)12-22-17-8-7-13(10-18(17)24(26)27)19(25)23-9-3-5-15(23)11-21/h1-2,4,6-8,10,15,22H,3,5,9,11-12,21H2 |
| InChIKey | SVOGRERSMWQECJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|