C25H23ClN4O5 — CID 55851230
[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-[4-(2-hydroxybenzoyl)piperazin-1-yl]methanone (PubChem CID 55851230) has the molecular formula C25H23ClN4O5 and a molecular weight of 494.94 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-[4-(2-hydroxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | [4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-[4-(2-hydroxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55851230 |
| Molecular Formula | C25H23ClN4O5 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-[4-(2-hydroxybenzoyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(NCc2ccccc2Cl)c([N+](=O)[O-])c1)N1CCN(C(=O)c2ccccc2O)CC1 |
| InChI | InChI=1S/C25H23ClN4O5/c26-20-7-3-1-5-18(20)16-27-21-10-9-17(15-22(21)30(34)35)24(32)28-11-13-29(14-12-28)25(33)19-6-2-4-8-23(19)31/h1-10,15,27,31H,11-14,16H2 |
| InChIKey | CRJSYDKERKZGHF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|