C23H22ClN5O3 — CID 112790800
[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 112790800) has the molecular formula C23H22ClN5O3 and a molecular weight of 451.91 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 112790800 |
| Molecular Formula | C23H22ClN5O3 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | [4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(NCc2ccccc2Cl)c([N+](=O)[O-])c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C23H22ClN5O3/c24-19-6-2-1-5-18(19)16-26-20-9-8-17(15-21(20)29(31)32)23(30)28-13-11-27(12-14-28)22-7-3-4-10-25-22/h1-10,15,26H,11-14,16H2 |
| InChIKey | JPUHBOLDDSCRCE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|